C15H20N6O3 — CID 133421298
3-nitro-N-[1-(oxolan-3-yl)piperidin-4-yl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133421298) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-nitro-N-[1-(oxolan-3-yl)piperidin-4-yl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-nitro-N-[1-(oxolan-3-yl)piperidin-4-yl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133421298 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-nitro-N-[1-(oxolan-3-yl)piperidin-4-yl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1cnc2ccc(NC3CCN(C4CCOC4)CC3)nn12 |
| InChI | InChI=1S/C15H20N6O3/c22-21(23)15-9-16-14-2-1-13(18-20(14)15)17-11-3-6-19(7-4-11)12-5-8-24-10-12/h1-2,9,11-12H,3-8,10H2,(H,17,18) |
| InChIKey | RNNXMZAUSYCBKL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|