C13H17N5O3 — CID 133420474
3-nitro-N-[1-(oxan-4-yl)ethyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 133420474) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-nitro-N-[1-(oxan-4-yl)ethyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-nitro-N-[1-(oxan-4-yl)ethyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133420474 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-nitro-N-[1-(oxan-4-yl)ethyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CC(Nc1ccc2ncc([N+](=O)[O-])n2n1)C1CCOCC1 |
| InChI | InChI=1S/C13H17N5O3/c1-9(10-4-6-21-7-5-10)15-11-2-3-12-14-8-13(18(19)20)17(12)16-11/h2-3,8-10H,4-7H2,1H3,(H,15,16) |
| InChIKey | FLXDXWQFOSULIS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|