C17H18N6O2 — CID 124741006
N-[(2R,3S)-1-methyl-2-phenylpyrrolidin-3-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine (PubChem CID 124741006) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[(2R,3S)-1-methyl-2-phenylpyrrolidin-3-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-[(2R,3S)-1-methyl-2-phenylpyrrolidin-3-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 124741006 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[(2R,3S)-1-methyl-2-phenylpyrrolidin-3-yl]-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CN1CC[C@H](Nc2ccc3ncc([N+](=O)[O-])n3n2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18N6O2/c1-21-10-9-13(17(21)12-5-3-2-4-6-12)19-14-7-8-15-18-11-16(23(24)25)22(15)20-14/h2-8,11,13,17H,9-10H2,1H3,(H,19,20)/t13-,17+/m0/s1 |
| InChIKey | VQYMHDXOOQUUNH-SUMWQHHRSA-N |
| XLogP | 2.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|