C15H18N4 — CID 100692874
N-[(2S,3S)-1-methyl-2-phenylpyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 100692874) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-[(2S,3S)-1-methyl-2-phenylpyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | N-[(2S,3S)-1-methyl-2-phenylpyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 100692874 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[(2S,3S)-1-methyl-2-phenylpyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | CN1CC[C@H](Nc2cnccn2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H18N4/c1-19-10-7-13(18-14-11-16-8-9-17-14)15(19)12-5-3-2-4-6-12/h2-6,8-9,11,13,15H,7,10H2,1H3,(H,17,18)/t13-,15-/m0/s1 |
| InChIKey | MAZHUZXAULMYKU-ZFWWWQNUSA-N |
| XLogP | 2.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |