C18H27N5O3 — CID 133315501
N-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3-nitrobenzamide (PubChem CID 133315501) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3-nitrobenzamide.
| Compound Name | N-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 133315501 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N-methyl-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(N2CCN(C3CCCN(C)C3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H27N5O3/c1-19-18(24)14-5-6-16(17(12-14)23(25)26)22-10-8-21(9-11-22)15-4-3-7-20(2)13-15/h5-6,12,15H,3-4,7-11,13H2,1-2H3,(H,19,24) |
| InChIKey | BRKXWRJXGALWKB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|