C15H25N5O — CID 14763494
4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carboxamide (PubChem CID 14763494) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 14763494 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-(4-aminophenyl)-N-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1CCN(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C15H25N5O/c1-18(2)8-7-17-15(21)20-11-9-19(10-12-20)14-5-3-13(16)4-6-14/h3-6H,7-12,16H2,1-2H3,(H,17,21) |
| InChIKey | IMIKATBBGSFGAC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|