C13H10N4O2S — CID 11701947
(5Z)-2-amino-5-[(4-methoxyquinazolin-6-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 11701947) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(4-methoxyquinazolin-6-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(4-methoxyquinazolin-6-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11701947 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (5Z)-2-amino-5-[(4-methoxyquinazolin-6-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ncnc2ccc(/C=C3\SC(N)=NC3=O)cc12 |
| InChI | InChI=1S/C13H10N4O2S/c1-19-12-8-4-7(2-3-9(8)15-6-16-12)5-10-11(18)17-13(14)20-10/h2-6H,1H3,(H2,14,17,18)/b10-5- |
| InChIKey | SKBCMSVIFMFFJT-YHYXMXQVSA-N |
| XLogP | 1.57 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|