C24H20N4O3S — CID 135461420
4-ethoxy-6-[(Z)-[2-[(1R)-2-hydroxy-1-phenylethyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile (PubChem CID 135461420) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-ethoxy-6-[(Z)-[2-[(1R)-2-hydroxy-1-phenylethyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile.
| Compound Name | 4-ethoxy-6-[(Z)-[2-[(1R)-2-hydroxy-1-phenylethyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 135461420 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-ethoxy-6-[(Z)-[2-[(1R)-2-hydroxy-1-phenylethyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile |
| SMILES | CCOc1c(C#N)cnc2ccc(/C=C3\S/C(=N/[C@@H](CO)c4ccccc4)NC3=O)cc12 |
| InChI | InChI=1S/C24H20N4O3S/c1-2-31-22-17(12-25)13-26-19-9-8-15(10-18(19)22)11-21-23(30)28-24(32-21)27-20(14-29)16-6-4-3-5-7-16/h3-11,13,20,29H,2,14H2,1H3,(H,27,28,30)/b21-11-/t20-/m0/s1 |
| InChIKey | IYZALMHWQWBBKN-KMRXCDNJSA-N |
| XLogP | 3.80 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|