C23H16F3N5O2S — CID 136658652
4-ethoxy-6-[[4-oxo-2-[[4-(trifluoromethyl)-2-pyridinyl]methylimino]-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile (PubChem CID 136658652) has the molecular formula C23H16F3N5O2S and a molecular weight of 483.48 g/mol. Its IUPAC name is 4-ethoxy-6-[[4-oxo-2-[[4-(trifluoromethyl)-2-pyridinyl]methylimino]-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile.
| Compound Name | 4-ethoxy-6-[[4-oxo-2-[[4-(trifluoromethyl)-2-pyridinyl]methylimino]-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 136658652 |
| Molecular Formula | C23H16F3N5O2S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-ethoxy-6-[[4-oxo-2-[[4-(trifluoromethyl)-2-pyridinyl]methylimino]-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carbonitrile |
| SMILES | CCOc1c(C#N)cnc2ccc(C=C3S/C(=N\Cc4cc(C(F)(F)F)ccn4)NC3=O)cc12 |
| InChI | InChI=1S/C23H16F3N5O2S/c1-2-33-20-14(10-27)11-29-18-4-3-13(7-17(18)20)8-19-21(32)31-22(34-19)30-12-16-9-15(5-6-28-16)23(24,25)26/h3-9,11H,2,12H2,1H3,(H,30,31,32) |
| InChIKey | RHUAHFWQQWEOQQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|