C21H17N5O2S2 — CID 135992979
6-[(Z)-[4-oxo-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-5-ylidene]methyl]-4-propan-2-yloxy-1,5-naphthyridine-3-carbonitrile (PubChem CID 135992979) has the molecular formula C21H17N5O2S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 6-[(Z)-[4-oxo-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-5-ylidene]methyl]-4-propan-2-yloxy-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-[4-oxo-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-5-ylidene]methyl]-4-propan-2-yloxy-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135992979 |
| Molecular Formula | C21H17N5O2S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 6-[(Z)-[4-oxo-2-(thiophen-2-ylmethylimino)-1,3-thiazolidin-5-ylidene]methyl]-4-propan-2-yloxy-1,5-naphthyridine-3-carbonitrile |
| SMILES | CC(C)Oc1c(C#N)cnc2ccc(/C=C3\S/C(=N/Cc4cccs4)NC3=O)nc12 |
| InChI | InChI=1S/C21H17N5O2S2/c1-12(2)28-19-13(9-22)10-23-16-6-5-14(25-18(16)19)8-17-20(27)26-21(30-17)24-11-15-4-3-7-29-15/h3-8,10,12H,11H2,1-2H3,(H,24,26,27)/b17-8- |
| InChIKey | IVLGQUDJKMAJTC-IUXPMGMMSA-N |
| XLogP | 4.11 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|