C17H16N2OS2 — CID 135592451
(5Z)-2-[(3,5-dimethylphenyl)methylimino]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135592451) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (5Z)-2-[(3,5-dimethylphenyl)methylimino]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-[(3,5-dimethylphenyl)methylimino]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135592451 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (5Z)-2-[(3,5-dimethylphenyl)methylimino]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(C/N=C2\NC(=O)/C(=C/c3cccs3)S2)c1 |
| InChI | InChI=1S/C17H16N2OS2/c1-11-6-12(2)8-13(7-11)10-18-17-19-16(20)15(22-17)9-14-4-3-5-21-14/h3-9H,10H2,1-2H3,(H,18,19,20)/b15-9- |
| InChIKey | QWVXSGOEGFAQFF-DHDCSXOGSA-N |
| XLogP | 4.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|