C16H11N2O3S2- — CID 135765886
4-methyl-3-[[(5E)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135765886) has the molecular formula C16H11N2O3S2- and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-methyl-3-[[(5E)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 4-methyl-3-[[(5E)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135765886 |
| Molecular Formula | C16H11N2O3S2- |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 4-methyl-3-[[(5E)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1/N=C1\NC(=O)/C(=C\c2cccs2)S1 |
| InChI | InChI=1S/C16H12N2O3S2/c1-9-4-5-10(15(20)21)7-12(9)17-16-18-14(19)13(23-16)8-11-3-2-6-22-11/h2-8H,1H3,(H,20,21)(H,17,18,19)/p-1/b13-8+ |
| InChIKey | XBVWPECBDKCOEB-MDWZMJQESA-M |
| XLogP | 2.31 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|