C15H10N2O2S2 — CID 137131206
N-[(5Z)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137131206) has the molecular formula C15H10N2O2S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[(5Z)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137131206 |
| Molecular Formula | C15H10N2O2S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-[(5Z)-4-oxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccccc2)S/C1=C\c1cccs1 |
| InChI | InChI=1S/C15H10N2O2S2/c18-13(10-5-2-1-3-6-10)16-15-17-14(19)12(21-15)9-11-7-4-8-20-11/h1-9H,(H,16,17,18,19)/b12-9- |
| InChIKey | QLSFDFJTYBWTDQ-XFXZXTDPSA-N |
| XLogP | 3.15 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|