C22H18N4O2S — CID 137130891
N-[(5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137130891) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[(5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137130891 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(5Z)-5-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | Cc1cc(/C=C2\S/C(=N/C(=O)c3ccccc3)NC2=O)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C22H18N4O2S/c1-14-11-17(15(2)26(14)18-9-6-10-23-13-18)12-19-21(28)25-22(29-19)24-20(27)16-7-4-3-5-8-16/h3-13H,1-2H3,(H,24,25,27,28)/b19-12- |
| InChIKey | DWZHXTRGTFWVFC-UNOMPAQXSA-N |
| XLogP | 3.89 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|