C23H17Cl2N3O2S — CID 137126921
4-chloro-N-[(5Z)-5-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137126921) has the molecular formula C23H17Cl2N3O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137126921 |
| Molecular Formula | C23H17Cl2N3O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | Cc1cc(/C=C2\S/C(=N/C(=O)c3ccc(Cl)cc3)NC2=O)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O2S/c1-13-11-16(14(2)28(13)19-9-7-18(25)8-10-19)12-20-22(30)27-23(31-20)26-21(29)15-3-5-17(24)6-4-15/h3-12H,1-2H3,(H,26,27,29,30)/b20-12- |
| InChIKey | RGUULUXEGRZIRD-NDENLUEZSA-N |
| XLogP | 5.80 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|