C21H18ClN3O3S — CID 137131074
4-chloro-N-[(5Z)-5-[(4-morpholin-4-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137131074) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[(4-morpholin-4-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[(4-morpholin-4-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137131074 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[(4-morpholin-4-ylphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccc(Cl)cc2)S/C1=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3S/c22-16-5-3-15(4-6-16)19(26)23-21-24-20(27)18(29-21)13-14-1-7-17(8-2-14)25-9-11-28-12-10-25/h1-8,13H,9-12H2,(H,23,24,26,27)/b18-13- |
| InChIKey | XVEPEABHDZJDNN-AQTBWJFISA-N |
| XLogP | 3.58 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|