C24H17FN2O3S — CID 137131087
N-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 137131087) has the molecular formula C24H17FN2O3S and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | N-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 137131087 |
| Molecular Formula | C24H17FN2O3S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[(5Z)-5-[[4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C1N/C(=N\C(=O)c2ccccc2)S/C1=C\c1ccc(OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H17FN2O3S/c25-19-8-4-5-17(13-19)15-30-20-11-9-16(10-12-20)14-21-23(29)27-24(31-21)26-22(28)18-6-2-1-3-7-18/h1-14H,15H2,(H,26,27,28,29)/b21-14- |
| InChIKey | XUYJFVXHEXOHTD-STZFKDTASA-N |
| XLogP | 4.80 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|