C18H16N4O4S2 — CID 173489011
1-[3-cyano-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]propan-2-yl methanesulfonate (PubChem CID 173489011) has the molecular formula C18H16N4O4S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[3-cyano-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]propan-2-yl methanesulfonate.
| Compound Name | 1-[3-cyano-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]propan-2-yl methanesulfonate |
|---|---|
| PubChem CID | 173489011 |
| Molecular Formula | C18H16N4O4S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-[3-cyano-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]propan-2-yl methanesulfonate |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccc3ncc(C#N)c(CC(C)OS(C)(=O)=O)c3c2)S1 |
| InChI | InChI=1S/C18H16N4O4S2/c1-10(26-28(2,24)25)5-13-12(8-19)9-21-15-4-3-11(6-14(13)15)7-16-17(23)22-18(20)27-16/h3-4,6-7,9-10H,5H2,1-2H3,(H2,20,22,23)/b16-7- |
| InChIKey | CHFNNLXOGHTLIB-APSNUPSMSA-N |
| XLogP | 2.15 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|