C17H16N4O3S — CID 173114789
6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2-methoxyethoxy)quinoline-3-carbonitrile (PubChem CID 173114789) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2-methoxyethoxy)quinoline-3-carbonitrile.
| Compound Name | 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2-methoxyethoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 173114789 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]-4-(2-methoxyethoxy)quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\NC(=O)C\S1=C\c1ccc2ncc(C#N)c(OCCOC)c2c1 |
| InChI | InChI=1S/C17H16N4O3S/c1-23-4-5-24-16-12(7-18)8-20-14-3-2-11(6-13(14)16)9-25-10-15(22)21-17(25)19/h2-3,6,8-9H,4-5,10H2,1H3,(H2,19,21,22) |
| InChIKey | UFQZARHLFUKCSQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|