C17H10F6N4O2S — CID 173114877
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]quinoline-3-carbonitrile (PubChem CID 173114877) has the molecular formula C17H10F6N4O2S and a molecular weight of 448.35 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]quinoline-3-carbonitrile.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 173114877 |
| Molecular Formula | C17H10F6N4O2S |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-1-ylidene)methyl]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\NC(=O)C\S1=C\c1ccc2ncc(C#N)c(OC(C(F)(F)F)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C17H10F6N4O2S/c18-16(19,20)14(17(21,22)23)29-13-9(4-24)5-26-11-2-1-8(3-10(11)13)6-30-7-12(28)27-15(30)25/h1-3,5-6,14H,7H2,(H2,25,27,28) |
| InChIKey | LBRAWWLYXYZXRX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|