C17H16N4OS2 — CID 91160516
6-[(2-amino-4-oxo-1,3-thiazol-1-ylidene)methyl]-4-propan-2-ylsulfanylquinoline-3-carbonitrile (PubChem CID 91160516) has the molecular formula C17H16N4OS2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 6-[(2-amino-4-oxo-1,3-thiazol-1-ylidene)methyl]-4-propan-2-ylsulfanylquinoline-3-carbonitrile.
| Compound Name | 6-[(2-amino-4-oxo-1,3-thiazol-1-ylidene)methyl]-4-propan-2-ylsulfanylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 91160516 |
| Molecular Formula | C17H16N4OS2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 6-[(2-amino-4-oxo-1,3-thiazol-1-ylidene)methyl]-4-propan-2-ylsulfanylquinoline-3-carbonitrile |
| SMILES | CC(C)Sc1c(C#N)cnc2ccc(C=S3CC(=O)N=C3N)cc12 |
| InChI | InChI=1S/C17H16N4OS2/c1-10(2)23-16-12(6-18)7-20-14-4-3-11(5-13(14)16)8-24-9-15(22)21-17(24)19/h3-5,7-8,10H,9H2,1-2H3,(H2,19,21,22) |
| InChIKey | XRKUXAMRAUFWHH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|