C19H20N4O2S — CID 174528252
4-(2,2-dimethylpropoxy)-6-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]quinoline-3-carbonitrile (PubChem CID 174528252) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxy)-6-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]quinoline-3-carbonitrile.
| Compound Name | 4-(2,2-dimethylpropoxy)-6-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 174528252 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-(2,2-dimethylpropoxy)-6-[(2-imino-4-oxo-1,3-thiazolidin-5-yl)methyl]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1/NC(=O)C(Cc2ccc3ncc(C#N)c(OCC(C)(C)C)c3c2)S1 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2,3)10-25-16-12(8-20)9-22-14-5-4-11(6-13(14)16)7-15-17(24)23-18(21)26-15/h4-6,9,15H,7,10H2,1-3H3,(H2,21,23,24) |
| InChIKey | KSJIOIUJKJVGFY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|