C31H30ClN5O5S — CID 135435406
ethyl 6-[(Z)-[2-[2-chloro-5-(cyclobutanecarbonylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-morpholin-4-ylquinoline-3-carboxylate (PubChem CID 135435406) has the molecular formula C31H30ClN5O5S and a molecular weight of 620.13 g/mol. Its IUPAC name is ethyl 6-[(Z)-[2-[2-chloro-5-(cyclobutanecarbonylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-morpholin-4-ylquinoline-3-carboxylate.
| Compound Name | ethyl 6-[(Z)-[2-[2-chloro-5-(cyclobutanecarbonylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-morpholin-4-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 135435406 |
| Molecular Formula | C31H30ClN5O5S |
| Molecular Weight | 620.13 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | ethyl 6-[(Z)-[2-[2-chloro-5-(cyclobutanecarbonylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-4-morpholin-4-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(/C=C3\S/C(=N/c4cc(NC(=O)C5CCC5)ccc4Cl)NC3=O)cc2c1N1CCOCC1 |
| InChI | InChI=1S/C31H30ClN5O5S/c1-2-42-30(40)22-17-33-24-9-6-18(14-21(24)27(22)37-10-12-41-13-11-37)15-26-29(39)36-31(43-26)35-25-16-20(7-8-23(25)32)34-28(38)19-4-3-5-19/h6-9,14-17,19H,2-5,10-13H2,1H3,(H,34,38)(H,35,36,39)/b26-15- |
| InChIKey | FLILEQSANAYTDU-YSMPRRRNSA-N |
| XLogP | 5.53 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.13 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|