C16H8ClFN4OS2 — CID 136594599
5-(2,1,3-benzothiadiazol-5-ylmethylidene)-2-(2-chloro-5-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136594599) has the molecular formula C16H8ClFN4OS2 and a molecular weight of 390.85 g/mol. Its IUPAC name is 5-(2,1,3-benzothiadiazol-5-ylmethylidene)-2-(2-chloro-5-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-(2,1,3-benzothiadiazol-5-ylmethylidene)-2-(2-chloro-5-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136594599 |
| Molecular Formula | C16H8ClFN4OS2 |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 5-(2,1,3-benzothiadiazol-5-ylmethylidene)-2-(2-chloro-5-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cc(F)ccc2Cl)SC1=Cc1ccc2nsnc2c1 |
| InChI | InChI=1S/C16H8ClFN4OS2/c17-10-3-2-9(18)7-12(10)19-16-20-15(23)14(24-16)6-8-1-4-11-13(5-8)22-25-21-11/h1-7H,(H,19,20,23) |
| InChIKey | MJEOOEQTXHSDKO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|