C26H23ClN4O4S — CID 173085781
6-[[2-[2-chloro-5-(2-methylpropanoylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethylquinoline-3-carboxylic acid (PubChem CID 173085781) has the molecular formula C26H23ClN4O4S and a molecular weight of 523.01 g/mol. Its IUPAC name is 6-[[2-[2-chloro-5-(2-methylpropanoylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethylquinoline-3-carboxylic acid.
| Compound Name | 6-[[2-[2-chloro-5-(2-methylpropanoylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 173085781 |
| Molecular Formula | C26H23ClN4O4S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 6-[[2-[2-chloro-5-(2-methylpropanoylamino)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethylquinoline-3-carboxylic acid |
| SMILES | CCc1nc2ccc(C=C3S/C(=N/c4cc(NC(=O)C(C)C)ccc4Cl)NC3=O)cc2cc1C(=O)O |
| InChI | InChI=1S/C26H23ClN4O4S/c1-4-19-17(25(34)35)11-15-9-14(5-8-20(15)29-19)10-22-24(33)31-26(36-22)30-21-12-16(6-7-18(21)27)28-23(32)13(2)3/h5-13H,4H2,1-3H3,(H,28,32)(H,34,35)(H,30,31,33) |
| InChIKey | XMICLTUFOHBCIO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|