C25H23ClN4O3S — CID 135428847
tert-butyl N-[[4-chloro-3-[[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]methyl]carbamate (PubChem CID 135428847) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is tert-butyl N-[[4-chloro-3-[[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-chloro-3-[[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135428847 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | tert-butyl N-[[4-chloro-3-[[(5E)-4-oxo-5-(quinolin-6-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(Cl)c(/N=C2/NC(=O)/C(=C\c3ccc4ncccc4c3)S2)c1 |
| InChI | InChI=1S/C25H23ClN4O3S/c1-25(2,3)33-24(32)28-14-16-6-8-18(26)20(12-16)29-23-30-22(31)21(34-23)13-15-7-9-19-17(11-15)5-4-10-27-19/h4-13H,14H2,1-3H3,(H,28,32)(H,29,30,31)/b21-13+ |
| InChIKey | UVZODIPKAATACU-FYJGNVAPSA-N |
| XLogP | 5.80 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|