C28H27FN2O3S — CID 137118746
(5Z)-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137118746) has the molecular formula C28H27FN2O3S and a molecular weight of 490.60 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137118746 |
| Molecular Formula | C28H27FN2O3S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-2-(2-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccccc3F)NC2=O)ccc1OCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C28H27FN2O3S/c1-5-33-25-14-20(10-11-24(25)34-16-21-18(3)12-17(2)13-19(21)4)15-26-27(32)31-28(35-26)30-23-9-7-6-8-22(23)29/h6-15H,5,16H2,1-4H3,(H,30,31,32)/b26-15- |
| InChIKey | MTRYAPFZFFJUTR-YSMPRRRNSA-N |
| XLogP | 6.62 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|