C20H17FN2O5S — CID 137140510
ethyl [4-[(Z)-[2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] carbonate (PubChem CID 137140510) has the molecular formula C20H17FN2O5S and a molecular weight of 416.43 g/mol. Its IUPAC name is ethyl [4-[(Z)-[2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] carbonate.
| Compound Name | ethyl [4-[(Z)-[2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] carbonate |
|---|---|
| PubChem CID | 137140510 |
| Molecular Formula | C20H17FN2O5S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | ethyl [4-[(Z)-[2-(2-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(/C=C2\S/C(=N/c3ccccc3F)NC2=O)cc1OC |
| InChI | InChI=1S/C20H17FN2O5S/c1-3-27-20(25)28-15-9-8-12(10-16(15)26-2)11-17-18(24)23-19(29-17)22-14-7-5-4-6-13(14)21/h4-11H,3H2,1-2H3,(H,22,23,24)/b17-11- |
| InChIKey | ZESFHXIQGZMOHX-BOPFTXTBSA-N |
| XLogP | 4.26 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|