C29H29ClN2O3S — CID 137173852
(5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137173852) has the molecular formula C29H29ClN2O3S and a molecular weight of 521.08 g/mol. Its IUPAC name is (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137173852 |
| Molecular Formula | C29H29ClN2O3S |
| Molecular Weight | 521.08 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[3-ethoxy-4-[(2,4,6-trimethylphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\S/C(=N/c3ccc(Cl)cc3C)NC2=O)ccc1OCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H29ClN2O3S/c1-6-34-26-14-21(7-10-25(26)35-16-23-18(3)11-17(2)12-19(23)4)15-27-28(33)32-29(36-27)31-24-9-8-22(30)13-20(24)5/h7-15H,6,16H2,1-5H3,(H,31,32,33)/b27-15- |
| InChIKey | IKAOUHGTOGISIW-DICXZTSXSA-N |
| XLogP | 7.44 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.08 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|