C24H16N4O5S — CID 137069529
2-[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-5-nitrobenzonitrile (PubChem CID 137069529) has the molecular formula C24H16N4O5S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-5-nitrobenzonitrile.
| Compound Name | 2-[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 137069529 |
| Molecular Formula | C24H16N4O5S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-5-nitrobenzonitrile |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3cccc(Oc4ccc([N+](=O)[O-])cc4C#N)c3)S2)cc1 |
| InChI | InChI=1S/C24H16N4O5S/c1-32-19-8-5-17(6-9-19)26-24-27-23(29)22(34-24)12-15-3-2-4-20(11-15)33-21-10-7-18(28(30)31)13-16(21)14-25/h2-13H,1H3,(H,26,27,29)/b22-12- |
| InChIKey | IFZWMWGAPUXDBC-UUYOSTAYSA-N |
| XLogP | 5.16 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|