C26H18Cl2FN3O5S — CID 126375118
2-[(5Z)-5-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 126375118) has the molecular formula C26H18Cl2FN3O5S and a molecular weight of 574.42 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126375118 |
| Molecular Formula | C26H18Cl2FN3O5S |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-[(5Z)-5-[[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(OCC(=O)Nc3ccccc3F)c(Cl)c2)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18Cl2FN3O5S/c27-16-6-8-17(9-7-16)30-23(33)13-32-25(35)22(38-26(32)36)12-15-5-10-21(18(28)11-15)37-14-24(34)31-20-4-2-1-3-19(20)29/h1-12H,13-14H2,(H,30,33)(H,31,34)/b22-12- |
| InChIKey | RPEWMSITBCZTPB-UUYOSTAYSA-N |
| XLogP | 5.82 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|