C23H22Cl2N2O5S — CID 126240355
ethyl 2-[2,6-dichloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126240355) has the molecular formula C23H22Cl2N2O5S and a molecular weight of 509.41 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126240355 |
| Molecular Formula | C23H22Cl2N2O5S |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(E)-[3-ethyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O5S/c1-4-27-22(29)19(33-23(27)26-15-6-8-16(30-3)9-7-15)12-14-10-17(24)21(18(25)11-14)32-13-20(28)31-5-2/h6-12H,4-5,13H2,1-3H3/b19-12+,26-23- |
| InChIKey | MVGPRTNXUSAGEX-FXDVSAFYSA-N |
| XLogP | 5.57 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|