C21H21ClN2O4S — CID 126252417
(5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126252417) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126252417 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Cl)c(OC)c(OC)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-5-24-20(25)18(12-13-10-16(22)19(28-4)17(11-13)27-3)29-21(24)23-14-6-8-15(26-2)9-7-14/h6-12H,5H2,1-4H3/b18-12+,23-21- |
| InChIKey | GVKCKQSALZZABQ-HPJGCCTDSA-N |
| XLogP | 4.99 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|