C28H24BrNO7S — CID 126057477
4-[[5-bromo-4-[(Z)-[2,4-dioxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126057477) has the molecular formula C28H24BrNO7S and a molecular weight of 598.47 g/mol. Its IUPAC name is 4-[[5-bromo-4-[(Z)-[2,4-dioxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[5-bromo-4-[(Z)-[2,4-dioxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126057477 |
| Molecular Formula | C28H24BrNO7S |
| Molecular Weight | 598.47 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | 4-[[5-bromo-4-[(Z)-[2,4-dioxo-3-(2-phenoxyethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CCOc3ccccc3)C2=O)c(Br)cc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H24BrNO7S/c1-2-35-23-14-20(22(29)16-24(23)37-17-18-8-10-19(11-9-18)27(32)33)15-25-26(31)30(28(34)38-25)12-13-36-21-6-4-3-5-7-21/h3-11,14-16H,2,12-13,17H2,1H3,(H,32,33)/b25-15- |
| InChIKey | HWTOKIMKKBCHJC-MYYYXRDXSA-N |
| XLogP | 6.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|