C18H22BrNO5S — CID 126245166
(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126245166) has the molecular formula C18H22BrNO5S and a molecular weight of 444.35 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126245166 |
| Molecular Formula | C18H22BrNO5S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-3-(3-methoxypropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(OCC)c(/C=C2/SC(=O)N(CCCOC)C2=O)cc1Br |
| InChI | InChI=1S/C18H22BrNO5S/c1-4-24-14-11-15(25-5-2)13(19)9-12(14)10-16-17(21)20(18(22)26-16)7-6-8-23-3/h9-11H,4-8H2,1-3H3/b16-10+ |
| InChIKey | XYWKTWCLFDVSRQ-MHWRWJLKSA-N |
| XLogP | 4.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|