C26H20BrFN2O5S — CID 4764675
4-[[5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 4764675) has the molecular formula C26H20BrFN2O5S and a molecular weight of 571.42 g/mol. Its IUPAC name is 4-[[5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4764675 |
| Molecular Formula | C26H20BrFN2O5S |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | 4-[[5-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | COc1cc(C=C2S/C(=N/c3ccc(C(=O)O)cc3)N(C)C2=O)cc(Br)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C26H20BrFN2O5S/c1-30-24(31)22(36-26(30)29-19-8-6-17(7-9-19)25(32)33)13-16-11-20(27)23(21(12-16)34-2)35-14-15-4-3-5-18(28)10-15/h3-13H,14H2,1-2H3,(H,32,33)/b22-13?,29-26+ |
| InChIKey | VIQNKNMOXKFALH-SXUNINJFSA-N |
| XLogP | 6.11 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|