C29H26BrN3O4S — CID 126165797
(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 126165797) has the molecular formula C29H26BrN3O4S and a molecular weight of 592.52 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126165797 |
| Molecular Formula | C29H26BrN3O4S |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-3-methyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccc(OCc3ccc(Br)cc3)cc2)S/C1=N/c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C29H26BrN3O4S/c1-32-28(35)26(17-20-7-11-25(12-8-20)37-19-21-5-9-23(30)10-6-21)38-29(32)31-24-4-2-3-22(18-24)27(34)33-13-15-36-16-14-33/h2-12,17-18H,13-16,19H2,1H3/b26-17+,31-29+ |
| InChIKey | NERYEYXDLQPLHL-IUQJVVIISA-N |
| XLogP | 5.73 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|