C30H28N4O6S — CID 126167414
(5E)-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126167414) has the molecular formula C30H28N4O6S and a molecular weight of 572.64 g/mol. Its IUPAC name is (5E)-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126167414 |
| Molecular Formula | C30H28N4O6S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | (5E)-3-ethyl-2-[3-(morpholine-4-carbonyl)phenyl]imino-5-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(OCc3ccc([N+](=O)[O-])cc3)cc2)S/C1=N/c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C30H28N4O6S/c1-2-33-29(36)27(18-21-8-12-26(13-9-21)40-20-22-6-10-25(11-7-22)34(37)38)41-30(33)31-24-5-3-4-23(19-24)28(35)32-14-16-39-17-15-32/h3-13,18-19H,2,14-17,20H2,1H3/b27-18+,31-30+ |
| InChIKey | WVCRQHPWBLACQM-SUORVCCOSA-N |
| XLogP | 5.27 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|