C19H15Cl2IN2O2S — CID 124532234
(5Z)-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 124532234) has the molecular formula C19H15Cl2IN2O2S and a molecular weight of 533.22 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124532234 |
| Molecular Formula | C19H15Cl2IN2O2S |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 531.93 |
| IUPAC Name | (5Z)-5-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/S/C(=C\c2cc(Cl)c(OCc3ccc(I)cc3)c(Cl)c2)C(=O)N1C |
| InChI | InChI=1S/C19H15Cl2IN2O2S/c1-23-19-24(2)18(25)16(27-19)9-12-7-14(20)17(15(21)8-12)26-10-11-3-5-13(22)6-4-11/h3-9H,10H2,1-2H3/b16-9-,23-19+ |
| InChIKey | RUYVRWVGFWOGJP-RHFGJHFGSA-N |
| XLogP | 5.71 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|