C20H18ClIN2O3S — CID 3386006
5-[[3-chloro-4-[(3-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 3386006) has the molecular formula C20H18ClIN2O3S and a molecular weight of 528.80 g/mol. Its IUPAC name is 5-[[3-chloro-4-[(3-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-chloro-4-[(3-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3386006 |
| Molecular Formula | C20H18ClIN2O3S |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 5-[[3-chloro-4-[(3-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/SC(=Cc2cc(Cl)c(OCc3cccc(I)c3)c(OC)c2)C(=O)N1C |
| InChI | InChI=1S/C20H18ClIN2O3S/c1-23-20-24(2)19(25)17(28-20)10-13-8-15(21)18(16(9-13)26-3)27-11-12-5-4-6-14(22)7-12/h4-10H,11H2,1-3H3/b17-10?,23-20+ |
| InChIKey | UEJZKMITUKTHCL-YBVOAWSWSA-N |
| XLogP | 5.06 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|