C29H29IN2O4S — CID 126237817
(5E)-5-[[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126237817) has the molecular formula C29H29IN2O4S and a molecular weight of 628.53 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126237817 |
| Molecular Formula | C29H29IN2O4S |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | (5E)-5-[[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)N(CC)C2=O)cc(I)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C29H29IN2O4S/c1-5-32-28(33)26(37-29(32)31-22-10-12-23(34-4)13-11-22)17-21-15-24(30)27(25(16-21)35-6-2)36-18-20-9-7-8-19(3)14-20/h7-17H,5-6,18H2,1-4H3/b26-17+,31-29- |
| InChIKey | DISKGLBUWBLMNX-BKMCGOQMSA-N |
| XLogP | 7.21 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|