C25H17F2I2NO4S — CID 126059717
(5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126059717) has the molecular formula C25H17F2I2NO4S and a molecular weight of 719.29 g/mol. Its IUPAC name is (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126059717 |
| Molecular Formula | C25H17F2I2NO4S |
| Molecular Weight | 719.29 g/mol |
| Exact Mass | 718.89 |
| IUPAC Name | (5Z)-3-[2-(4-fluorophenoxy)ethyl]-5-[[4-[(4-fluorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc(I)c(OCc3ccc(F)cc3)c(I)c2)C(=O)N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C25H17F2I2NO4S/c26-17-3-1-15(2-4-17)14-34-23-20(28)11-16(12-21(23)29)13-22-24(31)30(25(32)35-22)9-10-33-19-7-5-18(27)6-8-19/h1-8,11-13H,9-10,14H2/b22-13- |
| InChIKey | OFCZUCVCRNLINO-XKZIYDEJSA-N |
| XLogP | 6.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.29 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|