C21H16I2N2O7S — CID 5126349
ethyl 2-[5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 5126349) has the molecular formula C21H16I2N2O7S and a molecular weight of 694.24 g/mol. Its IUPAC name is ethyl 2-[5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 5126349 |
| Molecular Formula | C21H16I2N2O7S |
| Molecular Weight | 694.24 g/mol |
| Exact Mass | 693.88 |
| IUPAC Name | ethyl 2-[5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)SC(=Cc2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C21H16I2N2O7S/c1-2-31-18(26)10-24-20(27)17(33-21(24)28)9-13-7-15(22)19(16(23)8-13)32-11-12-3-5-14(6-4-12)25(29)30/h3-9H,2,10-11H2,1H3 |
| InChIKey | KGFRJZHSPIOJDN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|