C20H12I2N2O5S — CID 6088686
(5Z)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 6088686) has the molecular formula C20H12I2N2O5S and a molecular weight of 646.20 g/mol. Its IUPAC name is (5Z)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6088686 |
| Molecular Formula | C20H12I2N2O5S |
| Molecular Weight | 646.20 g/mol |
| Exact Mass | 645.86 |
| IUPAC Name | (5Z)-5-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)S/C(=C\c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)C1=O |
| InChI | InChI=1S/C20H12I2N2O5S/c1-2-7-23-19(25)17(30-20(23)26)10-13-8-15(21)18(16(22)9-13)29-11-12-3-5-14(6-4-12)24(27)28/h1,3-6,8-10H,7,11H2/b17-10- |
| InChIKey | QCPUMGCDUPXTGU-YVLHZVERSA-N |
| XLogP | 5.05 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|