C25H20FIN2O3 — CID 126238094
(5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126238094) has the molecular formula C25H20FIN2O3 and a molecular weight of 542.35 g/mol. Its IUPAC name is (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126238094 |
| Molecular Formula | C25H20FIN2O3 |
| Molecular Weight | 542.35 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | (5E)-5-[[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3ccc(OCc4cccc(F)c4)c(I)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H20FIN2O3/c1-16-5-7-17(8-6-16)14-29-24(30)22(28-25(29)31)13-18-9-10-23(21(27)12-18)32-15-19-3-2-4-20(26)11-19/h2-13H,14-15H2,1H3,(H,28,31)/b22-13+ |
| InChIKey | LTTBZQVGDHCDGE-LPYMAVHISA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|