C25H19ClI2N2O3 — CID 126254975
(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126254975) has the molecular formula C25H19ClI2N2O3 and a molecular weight of 684.70 g/mol. Its IUPAC name is (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126254975 |
| Molecular Formula | C25H19ClI2N2O3 |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 683.92 |
| IUPAC Name | (5E)-5-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)N/C(=C/c3cc(I)c(OCc4ccccc4Cl)c(I)c3)C2=O)c1 |
| InChI | InChI=1S/C25H19ClI2N2O3/c1-15-5-4-6-16(9-15)13-30-24(31)22(29-25(30)32)12-17-10-20(27)23(21(28)11-17)33-14-18-7-2-3-8-19(18)26/h2-12H,13-14H2,1H3,(H,29,32)/b22-12+ |
| InChIKey | QUQCPTANPKBLST-WSDLNYQXSA-N |
| XLogP | 6.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|