C25H17I2N3O3 — CID 126247596
2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-diiodophenoxy]methyl]benzonitrile (PubChem CID 126247596) has the molecular formula C25H17I2N3O3 and a molecular weight of 661.24 g/mol. Its IUPAC name is 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-diiodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-diiodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126247596 |
| Molecular Formula | C25H17I2N3O3 |
| Molecular Weight | 661.24 g/mol |
| Exact Mass | 660.94 |
| IUPAC Name | 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-diiodophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(I)cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)cc1I |
| InChI | InChI=1S/C25H17I2N3O3/c26-20-10-17(11-21(27)23(20)33-15-19-9-5-4-8-18(19)13-28)12-22-24(31)30(25(32)29-22)14-16-6-2-1-3-7-16/h1-12H,14-15H2,(H,29,32)/b22-12+ |
| InChIKey | NELXZLUSGFGDKU-WSDLNYQXSA-N |
| XLogP | 5.44 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|