C27H27IN2O4S — CID 57323354
3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 57323354) has the molecular formula C27H27IN2O4S and a molecular weight of 602.49 g/mol. Its IUPAC name is 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57323354 |
| Molecular Formula | C27H27IN2O4S |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1cc(I)c(OCc3ccccc3)c(C(C)(C)C)c1)C(=O)N2 |
| InChI | InChI=1S/C27H27IN2O4S/c1-27(2,3)22-13-18(14-23(28)25(22)34-16-17-8-6-5-7-9-17)12-21-20-15-19(35(32,33)29-4)10-11-24(20)30-26(21)31/h5-15,29H,16H2,1-4H3,(H,30,31) |
| InChIKey | AZAAGBJKEFDUQU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|