C30H31IN2O5S — CID 57229752
3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-5-morpholin-4-ylsulfonyl-1H-indol-2-one (PubChem CID 57229752) has the molecular formula C30H31IN2O5S and a molecular weight of 658.56 g/mol. Its IUPAC name is 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-5-morpholin-4-ylsulfonyl-1H-indol-2-one.
| Compound Name | 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-5-morpholin-4-ylsulfonyl-1H-indol-2-one |
|---|---|
| PubChem CID | 57229752 |
| Molecular Formula | C30H31IN2O5S |
| Molecular Weight | 658.56 g/mol |
| Exact Mass | 658.10 |
| IUPAC Name | 3-[(3-tert-butyl-5-iodo-4-phenylmethoxyphenyl)methylidene]-5-morpholin-4-ylsulfonyl-1H-indol-2-one |
| SMILES | CC(C)(C)c1cc(C=C2C(=O)Nc3ccc(S(=O)(=O)N4CCOCC4)cc32)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H31IN2O5S/c1-30(2,3)25-16-21(17-26(31)28(25)38-19-20-7-5-4-6-8-20)15-24-23-18-22(9-10-27(23)32-29(24)34)39(35,36)33-11-13-37-14-12-33/h4-10,15-18H,11-14,19H2,1-3H3,(H,32,34) |
| InChIKey | XNGAQHBMTZJLTE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|