C24H13Cl2F3N2O2 — CID 126114158
2-[[2,6-dichloro-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126114158) has the molecular formula C24H13Cl2F3N2O2 and a molecular weight of 489.28 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126114158 |
| Molecular Formula | C24H13Cl2F3N2O2 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-[[2,6-dichloro-4-[(Z)-[2-oxo-6-(trifluoromethyl)-1H-indol-3-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(/C=C2\C(=O)Nc3cc(C(F)(F)F)ccc32)cc1Cl |
| InChI | InChI=1S/C24H13Cl2F3N2O2/c25-19-8-13(9-20(26)22(19)33-12-15-4-2-1-3-14(15)11-30)7-18-17-6-5-16(24(27,28)29)10-21(17)31-23(18)32/h1-10H,12H2,(H,31,32)/b18-7- |
| InChIKey | REZYHJDCFNXRNB-WSVATBPTSA-N |
| XLogP | 6.96 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|